EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O8 |
| Net Charge | 0 |
| Average Mass | 348.307 |
| Monoisotopic Mass | 348.08452 |
| SMILES | COC(=O)c1cc(OC)c(O)c2oc3c(c(=O)c12)C(OC)OC(C)=C3 |
| InChI | InChI=1S/C17H16O8/c1-7-5-9-12(17(23-4)24-7)14(19)11-8(16(20)22-3)6-10(21-2)13(18)15(11)25-9/h5-6,17-18H,1-4H3 |
| InChIKey | MUNKFZROFNVDJU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium sp. (ncbitaxon:1769349) | - | DOI (10.1002/ejoc.200601020) | Strain: Gö 100/2 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetocyclinone A (CHEBI:192346) has role fungal metabolite (CHEBI:76946) |
| chaetocyclinone A (CHEBI:192346) has role marine metabolite (CHEBI:76507) |
| chaetocyclinone A (CHEBI:192346) is a aromatic ether (CHEBI:35618) |
| chaetocyclinone A (CHEBI:192346) is a cyclic ether (CHEBI:37407) |
| chaetocyclinone A (CHEBI:192346) is a cyclic ketone (CHEBI:3992) |
| chaetocyclinone A (CHEBI:192346) is a methyl ester (CHEBI:25248) |
| chaetocyclinone A (CHEBI:192346) is a organic heterotricyclic compound (CHEBI:26979) |
| chaetocyclinone A (CHEBI:192346) is a phenols (CHEBI:33853) |
| chaetocyclinone A (CHEBI:192346) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| methyl 6-hydroxy-1,7-dimethoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylate |
| Synonym | Source |
|---|---|
| methyl 6-hydroxy-1,7-dimethoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b][1]benzopyran-9-carboxylate | IUPAC |