EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O5 |
| Net Charge | 0 |
| Average Mass | 297.271 |
| Monoisotopic Mass | 297.10732 |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(=O)nc(N)nc21 |
| InChI | InChI=1S/C11H15N5O5/c1-20-7-6(18)4(2-17)21-10(7)16-3-13-5-8(16)14-11(12)15-9(5)19/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | OVYNGSFVYRPRCG-KQYNXXCUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-O-methylguanosine (CHEBI:19229) has role metabolite (CHEBI:25212) |
| 2'-O-methylguanosine (CHEBI:19229) is a methylguanosine (CHEBI:25307) |
| Incoming Relation(s) |
| 2'-O-methylguanosine residue (CHEBI:64655) is substituent group from 2'-O-methylguanosine (CHEBI:19229) |
| IUPAC Names |
|---|
| 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxytetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one |
| 2'-O-methylguanosine |
| Synonyms | Source |
|---|---|
| 2-amino-9-(2-O-methyl-β-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-one | IUPAC |
| gm | ChEBI |
| Gm19 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2'-O-methylguanosine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1227554 | Reaxys |
| CAS:2140-71-8 | ChemIDplus |
| Citations |
|---|