EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC(=O)c1cc(OC)c(O)c2oc3c(c(=O)c12)COC(C)=C3 |
| InChI | InChI=1S/C16H14O7/c1-7-4-10-9(6-22-7)13(17)12-8(16(19)21-3)5-11(20-2)14(18)15(12)23-10/h4-5,18H,6H2,1-3H3 |
| InChIKey | TURYTCNCTQTGRQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) | |
| Chaetomium sp. (ncbitaxon:1769349) | - | DOI (10.1002/ejoc.200601020) | Strain: Gö 100/2 |
| Phomopsis sp. HNY29-2B (ncbitaxon:1418122) | - | DOI (10.1002/cjoc.201700375) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetocyclinone B (CHEBI:192287) has role fungal metabolite (CHEBI:76946) |
| chaetocyclinone B (CHEBI:192287) has role marine metabolite (CHEBI:76507) |
| chaetocyclinone B (CHEBI:192287) is a aromatic ether (CHEBI:35618) |
| chaetocyclinone B (CHEBI:192287) is a cyclic ether (CHEBI:37407) |
| chaetocyclinone B (CHEBI:192287) is a cyclic ketone (CHEBI:3992) |
| chaetocyclinone B (CHEBI:192287) is a methyl ester (CHEBI:25248) |
| chaetocyclinone B (CHEBI:192287) is a organic heterotricyclic compound (CHEBI:26979) |
| chaetocyclinone B (CHEBI:192287) is a phenols (CHEBI:33853) |
| chaetocyclinone B (CHEBI:192287) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| methyl 6-hydroxy-7-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylate |
| Synonym | Source |
|---|---|
| methyl 6-hydroxy-7-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b][1]benzopyran-9-carboxylate | IUPAC |
| Citations |
|---|