EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N6O7 |
| Net Charge | 0 |
| Average Mass | 584.674 |
| Monoisotopic Mass | 584.29585 |
| SMILES | CCCC[C@@H](NC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](CCCCN)C(=O)OC |
| InChI | InChI=1S/C29H40N6O7/c1-3-4-12-23(26(36)32-24(28(38)42-2)13-8-9-18-30)33-29(39)34-25(19-20-10-6-5-7-11-20)27(37)31-21-14-16-22(17-15-21)35(40)41/h5-7,10-11,14-17,23-25H,3-4,8-9,12-13,18-19,30H2,1-2H3,(H,31,37)(H,32,36)(H2,33,34,39)/t23-,24+,25+/m1/s1 |
| InChIKey | KEATTYUTWJKTRT-DSITVLBTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | somatostatin receptor agonist An agonist that binds to and activates somatostatin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-796,778 (CHEBI:192264) has role somatostatin receptor agonist (CHEBI:177023) |
| L-796,778 (CHEBI:192264) is a C-nitro compound (CHEBI:35716) |
| L-796,778 (CHEBI:192264) is a L-lysine derivative (CHEBI:25095) |
| L-796,778 (CHEBI:192264) is a L-phenylalanine derivative (CHEBI:84144) |
| L-796,778 (CHEBI:192264) is a benzenes (CHEBI:22712) |
| L-796,778 (CHEBI:192264) is a methyl ester (CHEBI:25248) |
| L-796,778 (CHEBI:192264) is a oligopeptide (CHEBI:25676) |
| L-796,778 (CHEBI:192264) is a secondary carboxamide (CHEBI:140325) |
| L-796,778 (CHEBI:192264) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| methyl N-{[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl}-D-norleucyl-L-lysinate |
| Synonyms | Source |
|---|---|
| L 796778 | ChemIDplus |
| L-796778 | ChEBI |
| L796778 | ChemIDplus |
| methyl (2S)-6-amino-2-[[(2R)-2-[[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoylamino]hexanoyl]amino]hexanoate | IUPAC |
| methyl (2S)-6-amino-2-{[(2R)-2-({[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl}amino)hexanoyl]amino}hexanoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 4470866 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:217480-25-6 | ChemIDplus |
| Citations |
|---|