EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10ClNO3 |
| Net Charge | 0 |
| Average Mass | 275.691 |
| Monoisotopic Mass | 275.03492 |
| SMILES | O=Cc1c(Cl)cccc1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10ClNO3/c15-11-5-3-7-13(10(11)8-17)16-12-6-2-1-4-9(12)14(18)19/h1-8,16H,(H,18,19) |
| InChIKey | LGDLLXQRAYRQSC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-formyl-3-chlorophenyl)anthranilic acid (CHEBI:192224) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-(3-chloro-2-ormylanilino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30778506 | ChemSpider |
| HMDB0060006 | HMDB |