EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31Cl2N5O7 |
| Net Charge | 0 |
| Average Mass | 572.446 |
| Monoisotopic Mass | 571.16005 |
| SMILES | CCC1NC(=O)CC(c2ccccc2)NC(=O)C2C(Cl)C(Cl)CN2C(=O)C(CO)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C24H31Cl2N5O7/c1-2-14-21(35)29-16(10-32)22(36)30-17(11-33)24(38)31-9-13(25)19(26)20(31)23(37)28-15(8-18(34)27-14)12-6-4-3-5-7-12/h3-7,13-17,19-20,32-33H,2,8-11H2,1H3,(H,27,34)(H,28,37)(H,29,35)(H,30,36) |
| InChIKey | AIUAVRQIJPKJTG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Islanditoxin (CHEBI:192211) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 17,18-dichloro-9-ethyl-3,6-bis(hydroxymethyl)-13-phenyl-1,4,7,10,14-pentazabicyclo[14.3.0]nonadecane-2,5,8,11,15-pentone |
| Manual Xrefs | Databases |
|---|---|
| 102758 | ChemSpider |
| HMDB0030458 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:10089-09-5 | ChemIDplus |