EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S |
| Net Charge | 0 |
| Average Mass | 208.239 |
| Monoisotopic Mass | 208.05178 |
| SMILES | NC(CS)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c7-3(2-13)5(10)8-4(1-9)6(11)12/h3-4,9,13H,1-2,7H2,(H,8,10)(H,11,12) |
| InChIKey | YXQDRIRSAHTJKM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cysteinyl-Serine (CHEBI:192197) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-sulanylpropanoyl)amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15746256 | ChemSpider |
| HMDB0028784 | HMDB |