EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(=C)C(=O)O)[C@]1([H])[C@H](O)CC1CCCC[C@@]12C |
| InChI | InChI=1S/C27H44O3/c1-17(8-7-9-18(2)25(29)30)20-11-12-21-24-22(13-15-27(20,21)4)26(3)14-6-5-10-19(26)16-23(24)28/h17,19-24,28H,2,5-16H2,1,3-4H3,(H,29,30)/t17-,19?,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| InChIKey | XEJKSEBLFRAKDR-AAQHJAISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7alpha,27-dihydroxycholestenone (CHEBI:192167) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (6R)-6-[(7R,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylideneheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 67492138 | ChemSpider |