EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C8H9NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h3-6H,2H2,1H3 |
| InChIKey | XBLVHTDFJBKJLG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl nicotinate (CHEBI:192166) is a aromatic carboxylic acid (CHEBI:33859) |
| Ethyl nicotinate (CHEBI:192166) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| ethyl pyridine-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 62402 | ChemSpider |
| D08274 | KEGG DRUG |
| HMDB0059846 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:614-18-6 | ChemIDplus |