EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N5O3 |
| Net Charge | 0 |
| Average Mass | 401.511 |
| Monoisotopic Mass | 401.24269 |
| SMILES | O=C1CC2(CCCC2)C(O)C(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H31N5O3/c27-17-16-21(6-1-2-7-21)18(28)19(29)26(17)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20/h5,8-9,18,28H,1-4,6-7,10-16H2 |
| InChIKey | KOZNAHJIJGCFJJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy buspirone (CHEBI:192155) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| 10-hydroxy-8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061110 | HMDB |
| 8106544 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:125481-61-0 | ChemIDplus |