EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CCC/C=C/C=C/CCC(=O)O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h4-7H,2-3,8-9H2,1H3,(H,11,12)/b5-4+,7-6+ |
| InChIKey | PPOWOHYQDRHGKT-YTXTXJHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4E,6E-decadienoic acid (CHEBI:192143) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (4E,6E)-deca-4,6-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445913 | ChemSpider |
| LMFA01030108 | LIPID MAPS |