EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | CCCc1cc(C)c(CCCCCCC(=O)O)o1 |
| InChI | InChI=1S/C15H24O3/c1-3-8-13-11-12(2)14(18-13)9-6-4-5-7-10-15(16)17/h11H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | KADQLABOEAJORF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methyl-5-propyl-2-furanheptanoic acid (CHEBI:192132) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 7-(3-methyl-5-propyluran-2-yl)heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849750 | ChemSpider |
| HMDB0112094 | HMDB |