EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O2 |
| Net Charge | 0 |
| Average Mass | 140.182 |
| Monoisotopic Mass | 140.08373 |
| SMILES | C=CCCC/C=C/C(=O)O |
| InChI | InChI=1S/C8H12O2/c1-2-3-4-5-6-7-8(9)10/h2,6-7H,1,3-5H2,(H,9,10)/b7-6+ |
| InChIKey | NZEBVMIRSIBPJJ-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2E,7-Octadienoic acid (CHEBI:192127) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E)-octa-2,7-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15562278 | ChemSpider |
| LMFA01030795 | LIPID MAPS |