EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | CC(C)=CCc1c(O)cc(O)c(CC(=O)O)c1O |
| InChI | InChI=1S/C13H16O5/c1-7(2)3-4-8-10(14)6-11(15)9(13(8)18)5-12(16)17/h3,6,14-15,18H,4-5H2,1-2H3,(H,16,17) |
| InChIKey | JGBMKZWTRNSXQV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[2,4,6-trihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]acetic acid (CHEBI:192122) is a phenols (CHEBI:33853) |
| 2-[2,4,6-trihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]acetic acid (CHEBI:192122) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| 2-[2,4,6-trihydroxy-3-(3-methylbut-2-enyl)phenyl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851719 | ChemSpider |
| HMDB0125460 | HMDB |