EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O2 |
| Net Charge | 0 |
| Average Mass | 334.544 |
| Monoisotopic Mass | 334.28718 |
| SMILES | CCCCCCCC/C=C/C/C=C\C/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10,12-13,15-16H,2-8,11,14,17-21H2,1H3,(H,23,24)/b10-9+,13-12-,16-15- |
| InChIKey | OEPMAZVWYGAFLM-SLWLPBBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (all-Z)-7,10,13-Docosatrienoic acid (CHEBI:192109) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (7Z,10Z,13E)-docosa-7,10,13-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031099 | HMDB |
| 30776883 | ChemSpider |