EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O4 |
| Net Charge | 0 |
| Average Mass | 316.482 |
| Monoisotopic Mass | 316.26136 |
| SMILES | CCC(O)C(O)CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O4/c1-2-16(19)17(20)14-12-10-8-6-4-3-5-7-9-11-13-15-18(21)22/h16-17,19-20H,2-15H2,1H3,(H,21,22) |
| InChIKey | LSFLNLHTOKKPHT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marine plankton environmental sample (ncbitaxon:632957) | - | MetaboLights (MTBLS4424) | Found in endometabolome. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-15,16-Dihydroxyoctadecanoic acid (CHEBI:192106) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 15,16-dihydroxyoctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472191 | ChemSpider |
| HMDB0031008 | HMDB |
| LMFA01050196 | LIPID MAPS |