EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N5O4 |
| Net Charge | 0 |
| Average Mass | 385.424 |
| Monoisotopic Mass | 385.17500 |
| SMILES | C[C@H](Cc1ccccc1)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N5O4/c1-11(7-12-5-3-2-4-6-12)23-17-14-18(21-9-20-17)24(10-22-14)19-16(27)15(26)13(8-25)28-19/h2-6,9-11,13,15-16,19,25-27H,7-8H2,1H3,(H,20,21,23)/t11-,13-,15-,16-,19-/m1/s1 |
| InChIKey | RIRGCFBBHQEQQH-SSFGXONLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | adenosine A1 receptor agonist An agonist at the A1 receptor. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) has functional parent adenosine (CHEBI:16335) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) has role adenosine A1 receptor agonist (CHEBI:65057) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) has role neuroprotective agent (CHEBI:63726) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) is a aromatic amine (CHEBI:33860) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) is a benzenes (CHEBI:22712) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) is a hydrocarbyladenosine (CHEBI:24909) |
| (−)-N6-(2-phenylisopropyl)adenosine (CHEBI:192091) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-[(2R)-1-phenylpropan-2-yl]adenosine |
| Synonyms | Source |
|---|---|
| (−)-N6-(2-phenylisopropyl)adenosine | ChEBI |
| N6-[(R)-1-methyl-2-phenylethyl]adenosine | ChEBI |
| N6-(R)-phenylisopropyladenosine | ChEBI |
| N6-D-phenylisopropyladenosine | ChemIDplus |
| N6-(L-2-phenylisopropyl)adenosine | ChEBI |
| (−)-N-(α-methylphenethyl)adenosine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 84148 | ChemSpider |
| WO2021099832 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4912716 | Reaxys |
| CAS:38594-96-6 | ChemIDplus |
| Citations |
|---|