EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192085 - L-tyrosine-d4
| Formula | C9H7D4NO3 |
| Net Charge | 0 |
| Average Mass | 185.215 |
| Monoisotopic Mass | 185.09900 |
| SMILES | [2H]c1c([2H])c(C[C@H](N)C(=O)O)c([2H])c([2H])c1O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D,3D,4D |
| InChIKey | OUYCCCASQSFEME-FCDGGRDXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.3.1.43 (arogenate dehydrogenase) inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of arogenate dehydrogenase (EC 1.3.1.43). fundamental metabolite Any metabolite produced by all living cells. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosine-d4 (CHEBI:192085) is a L-tyrosine (CHEBI:17895) |
| L-tyrosine-d4 (CHEBI:192085) is a deuterated compound (CHEBI:76107) |