EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7D4NO3 |
| Net Charge | 0 |
| Average Mass | 185.215 |
| Monoisotopic Mass | 185.09900 |
| SMILES | [2H]c1c([2H])c(C[C@H](N)C(=O)O)c([2H])c([2H])c1O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D,3D,4D |
| InChIKey | OUYCCCASQSFEME-FCDGGRDXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. fundamental metabolite Any metabolite produced by all living cells. EC 1.3.1.43 (arogenate dehydrogenase) inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of arogenate dehydrogenase (EC 1.3.1.43). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosine-d4 (CHEBI:192085) is a L-tyrosine (CHEBI:17895) |
| L-tyrosine-d4 (CHEBI:192085) is a deuterated compound (CHEBI:76107) |