EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10FN5O |
| Net Charge | 0 |
| Average Mass | 259.244 |
| Monoisotopic Mass | 259.08694 |
| SMILES | COc1cccc(Nc2nc(F)nc3ncnc23)c1 |
| InChI | InChI=1S/C12H10FN5O/c1-19-8-4-2-3-7(5-8)16-11-9-10(15-6-14-9)17-12(13)18-11/h2-6H,1H3,(H2,14,15,16,17,18) |
| InChIKey | KJBRXNXZODWCMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisiflupurin (CHEBI:192082) has role cytokinin (CHEBI:23530) |
| anisiflupurin (CHEBI:192082) has role plant growth regulator (CHEBI:26155) |
| anisiflupurin (CHEBI:192082) is a 6-aminopurines (CHEBI:20706) |
| anisiflupurin (CHEBI:192082) is a monomethoxybenzene (CHEBI:25235) |
| anisiflupurin (CHEBI:192082) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2-fluoro-N-(3-methoxyphenyl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 2-fluoro-6-(3-methoxyanilino)purine | ChemIDplus |
| anisiflupurine | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 24700547 | ChemSpider |
| 3357 | PPDB |
| anisiflupurin | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:1089014-47-0 | ChemIDplus |
| Citations |
|---|