EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4D7NO4 |
| Net Charge | 0 |
| Average Mass | 140.146 |
| Monoisotopic Mass | 140.08144 |
| SMILES | [2H]OC(=O)C([2H])([2H])[C@@]([2H])(C(=O)O[2H])N([2H])[2H] |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D2,2D/hD4 |
| InChIKey | CKLJMWTZIZZHCS-IAAZBAKNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-aspartic acid-d7 (CHEBI:192076) is a L-aspartic acid (CHEBI:17053) |
| L-aspartic acid-d7 (CHEBI:192076) is a deuterated compound (CHEBI:76107) |