EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O10 |
| Net Charge | 0 |
| Average Mass | 526.538 |
| Monoisotopic Mass | 526.18390 |
| SMILES | [H][C@]12C=CC3=C[C@@H](O)CC(=O)[C@]3(C)[C@]1([H])CC[C@@]1(O)C(=O)O[C@]3(C)[C@@]14O[C@@]21OC[C@]2([H])C(=O)O[C@@]3([H])C[C@]2(C)[C@@]4([H])C1=O |
| InChI | InChI=1S/C28H30O10/c1-23-10-18-25(3)28-19(23)20(31)27(38-28,35-11-16(23)21(32)36-18)15-5-4-12-8-13(29)9-17(30)24(12,2)14(15)6-7-26(28,34)22(33)37-25/h4-5,8,13-16,18-19,29,34H,6-7,9-11H2,1-3H3/t13-,14-,15+,16?,18+,19-,23+,24+,25+,26?,27?,28?/m1/s1 |
| InChIKey | JMNMXSXLYDOMTI-AEEQHBTFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus trichocarpa (ncbitaxon:3694) | root (BTO:0001188) | MetaboLights (MTBLS4196) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isophysalin G (CHEBI:192055) is a physalin (CHEBI:76361) |
| IUPAC Name |
|---|
| (1R,2S,5R,8S,9R,12S,17R,18R,21S,24R,26S,27S)-5,12-dihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacosa-13,15-diene-4,10,22,29-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 24710172 | ChemSpider |