EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26O15 |
| Net Charge | 0 |
| Average Mass | 614.512 |
| Monoisotopic Mass | 614.12717 |
| SMILES | O=C(/C=C\c1ccccc1)OC1C(OC(=O)c2cc(O)c(O)c(O)c2)OC(COC(=O)c2cc(O)c(O)c(O)c2)C(O)C1O |
| InChI | InChI=1S/C29H26O15/c30-16-8-14(9-17(31)22(16)35)27(39)41-12-20-24(37)25(38)26(43-21(34)7-6-13-4-2-1-3-5-13)29(42-20)44-28(40)15-10-18(32)23(36)19(33)11-15/h1-11,20,24-26,29-33,35-38H,12H2/b7-6- |
| InChIKey | AKNNKSLRUQXXCZ-SREVYHEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus trichocarpa (ncbitaxon:3694) | root (BTO:0001188) | MetaboLights (MTBLS4196) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Cinnamoyl-1,6-digalloyl-beta-D-glucopyranose (CHEBI:192048) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [3,4-dihydroxy-5-[(Z)-3-phenylprop-2-enoyl]oxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039192 | HMDB |