EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@]4(C)CCCC(C)(C)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H52O3/c1-25(2)13-9-14-30(8,33-25)19-10-16-29(7)24(19)20(31)18-22-27(5)15-12-23(32)26(3,4)21(27)11-17-28(22,29)6/h19-24,31-32H,9-18H2,1-8H3/t19-,20+,21-,22+,23-,24-,27-,28+,29+,30+/m0/s1 |
| InChIKey | PVLHOJXLNBFHDX-XHJPDDKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus trichocarpa (ncbitaxon:3694) | root (BTO:0001188) | MetaboLights (MTBLS4196) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Panaxadiol (CHEBI:192043) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3S,5R,8R,9R,10R,12R,13R,14R,17S)-4,4,8,10,14-pentamethyl-17-[(2R)-2,6,6-trimethyloxan-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| Manual Xrefs | Databases |
|---|---|
| 66186 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:19666-76-3 | ChemIDplus |