EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | C=CC(=O)OCCCCCCCCCCCC |
| InChI | InChI=1S/C15H28O2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h4H,2-3,5-14H2,1H3 |
| InChIKey | PBOSTUDLECTMNL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smaug giganteus (ncbitaxon:885422) | - | PubMed (17805931) | Species also known as Cordylus giganteus. |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lauryl acrylate (CHEBI:191951) has functional parent acrylic acid (CHEBI:18308) |
| lauryl acrylate (CHEBI:191951) has functional parent dodecan-1-ol (CHEBI:28878) |
| lauryl acrylate (CHEBI:191951) has role animal metabolite (CHEBI:75767) |
| lauryl acrylate (CHEBI:191951) has role pheromone (CHEBI:26013) |
| lauryl acrylate (CHEBI:191951) is a acrylate ester (CHEBI:50424) |
| IUPAC Name |
|---|
| dodecyl prop-2-enoate |
| Synonyms | Source |
|---|---|
| 2-propenoic acid dodecyl ester | ChEBI |
| 2-propenoic acid, dodecyl ester | ChemIDplus |
| acrylic acid dodecyl ester | ChEBI |
| acrylic acid, dodecyl ester | ChemIDplus |
| acrylic acid lauryl ester | ChEBI |
| dodecyl acrylate | ChemIDplus |
| Citations |
|---|