EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | DTGKSKDOIYIVQL-OYNCUSHFSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-isoborneol (CHEBI:191949) is a borneol (CHEBI:28093) |
| Synonym | Source |
|---|---|
| (S,S,S)-(+)-isoborneol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (+)-isoborneol | UniProt |
| Citations |
|---|