EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | DTGKSKDOIYIVQL-OYNCUSHFSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-isoborneol (CHEBI:191949) is a borneol (CHEBI:28093) |
| Synonym | Source |
|---|---|
| (S,S,S)-(+)-isoborneol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (+)-isoborneol | UniProt |
| Citations |
|---|