EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | CC(=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H10O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
| InChIKey | XNCRUNXWPDJHGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli E2265 (ncbitaxon:1331062) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3540) | |
| Escherichia coli E1777 (ncbitaxon:1331061) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3540) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-Methyl-cinnamic acid (CHEBI:191937) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| 2-methyl-3-phenylprop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13883 | ChemSpider |