EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O6 |
| Net Charge | 0 |
| Average Mass | 412.482 |
| Monoisotopic Mass | 412.18859 |
| SMILES | [H][C@@]12O[C@H](C)[C@@H](C)c3c(C)c(O)cc(c31)OC1=C2C(=O)C(C)=C2[C@H](C)[C@@H](C)O[C@@]12OC |
| InChI | InChI=1S/C24H28O6/c1-9-13(5)28-22-18-16(8-15(25)11(3)17(9)18)29-23-19(22)21(26)12(4)20-10(2)14(6)30-24(20,23)27-7/h8-10,13-14,22,25H,1-7H3/t9-,10-,13-,14-,22-,24-/m1/s1 |
| InChIKey | YWUROUQKOJZPEJ-ZPLCETTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (18281952) | Strain: B-57 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicitrinol B (CHEBI:191934) has role fungal metabolite (CHEBI:76946) |
| penicitrinol B (CHEBI:191934) has role radical scavenger (CHEBI:48578) |
| penicitrinol B (CHEBI:191934) is a ether (CHEBI:25698) |
| penicitrinol B (CHEBI:191934) is a furopyranoxanthene (CHEBI:191935) |
| penicitrinol B (CHEBI:191934) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2R,3S,5bR,7R,8S,12bR)-10-hydroxy-12b-methoxy-2,3,4,7,8,9-hexamethyl-2,3,5b,7,8,12b-hexahydro-5H-furo[3,2-c]pyrano[4,3,2-kl]xanthen-5-one |
| Synonym | Source |
|---|---|
| (1R,6S,7R,9R,17S,18R)-14-hydroxy-9-methoxy-4,6,7,15,17,18-hexamethyl-8,11,19-trioxapentacyclo[10.7.1.02,10.05,9.016,20]icosa-2(10),4,12(20),13,15-pentaen-3-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 23340846 | ChemSpider |
| Citations |
|---|