EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O6 |
| Net Charge | 0 |
| Average Mass | 398.455 |
| Monoisotopic Mass | 398.17294 |
| SMILES | Cc1c([C@H](C)[C@H](C)O)c(O)c2oc3cc(=O)c(C)c4c-3c(c2c1O)O[C@H](C)[C@H]4C |
| InChI | InChI=1S/C23H26O6/c1-8(12(5)24)17-11(4)20(26)19-22-18-15(29-23(19)21(17)27)7-14(25)10(3)16(18)9(2)13(6)28-22/h7-9,12-13,24,26-27H,1-6H3/t8-,9-,12+,13-/m1/s1 |
| InChIKey | HESPWWKIRCFDQL-MNUQUWEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (18281952) | Strain: B-57 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pennicitrinone C (CHEBI:191933) has role fungal metabolite (CHEBI:76946) |
| pennicitrinone C (CHEBI:191933) has role radical scavenger (CHEBI:48578) |
| pennicitrinone C (CHEBI:191933) is a phenols (CHEBI:33853) |
| pennicitrinone C (CHEBI:191933) is a pyranoxanthene (CHEBI:64515) |
| pennicitrinone C (CHEBI:191933) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,3S)-8,11-dihydroxy-9-[(2S,3S)-3-hydroxybutan-2-yl]-2,3,4,10-tetramethyl-2,3-dihydro-5H-pyrano[4,3,2-kl]xanthen-5-one |
| Synonym | Source |
|---|---|
| (14S,15R)-3,6-dihydroxy-5-[(2S,3S)-3-hydroxybutan-2-yl]-4,12,14,15-tetramethyl-8,16-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,12-hexaen-11-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 23340845 | ChemSpider |
| Citations |
|---|