EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CCCC/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h5-6H,2-4,7-10H2,1H3,(H,12,13)/b6-5+ |
| InChIKey | DRIWYILTZPGTFU-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS4638) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-undecenoic acid (CHEBI:191897) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-undec-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472153 | ChemSpider |
| LMFA01030608 | LIPID MAPS |