EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O6 |
| Net Charge | 0 |
| Average Mass | 348.310 |
| Monoisotopic Mass | 348.06339 |
| SMILES | O=C1OCc2c1cc1ccc3c(c1c2-c1ccc2c(c1)OCO2)OCO3 |
| InChI | InChI=1S/C20H12O6/c21-20-12-5-10-2-4-15-19(26-9-24-15)18(10)17(13(12)7-22-20)11-1-3-14-16(6-11)25-8-23-14/h1-6H,7-9H2 |
| InChIKey | JUBRYHUFFFYTGR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eleutherococcus divaricatus var. chiisanensis (ncbitaxon:96666) | Root (BTO:0001188) | PubMed (12392817) | Species also known as Acanthopanax chiisanensis. |
| Taiwania cryptomerioides (ncbitaxon:50187) | - | PubMed (26464283) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| helioxanthin (CHEBI:191856) has role anti-HBV agent (CHEBI:64951) |
| helioxanthin (CHEBI:191856) has role antineoplastic agent (CHEBI:35610) |
| helioxanthin (CHEBI:191856) has role plant metabolite (CHEBI:76924) |
| helioxanthin (CHEBI:191856) is a benzodioxoles (CHEBI:38298) |
| helioxanthin (CHEBI:191856) is a furonaphthodioxole (CHEBI:50307) |
| helioxanthin (CHEBI:191856) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 10-(1,3-benzodioxol-5-yl)furo[3',4':6,7]naphtho[1,2-d][1,3]dioxol-7(9H)-one |
| Synonyms | Source |
|---|---|
| 10-(1,3-benzodioxol-5-yl)-9H-[2]benzofuro[6,5-g][1,3]benzodioxol-7-one | ChEBI |
| 10-(2H-1,3-benzodioxol-5-yl)-2H-furo[3',4':6,7]naphtho[1,2-d][1,3]dioxol-7(9H)-one | IUPAC |
| HE-145 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:18920-47-3 | ChemIDplus |
| Citations |
|---|