EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36ClNO |
| Net Charge | 0 |
| Average Mass | 365.989 |
| Monoisotopic Mass | 365.24854 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCCl |
| InChI | InChI=1S/C22H36ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)24-21-20-23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21H2,1H3,(H,24,25)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | SCJNCDSAIRBRIA-DOFZRALJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB2 receptor agonist A cannabinoid receptor agonist that binds to and activates type 2 cannabinoid receptors. CB1 receptor agonist A cannabinoid receptor agonist that binds to and activates type 1 cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) has functional parent arachidonic acid (CHEBI:15843) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) has role CB1 receptor agonist (CHEBI:192269) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) has role CB2 receptor agonist (CHEBI:146246) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) has role neuroprotective agent (CHEBI:63726) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) is a fatty amide (CHEBI:29348) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) is a organochlorine compound (CHEBI:36683) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) is a secondary carboxamide (CHEBI:140325) |
| arachidonyl-2'-chloroethylamide (CHEBI:191854) is a synthetic cannabinoid (CHEBI:67201) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-N-(2-chloroethyl)icosa-5,8,11,14-tetraenamide |
| Synonyms | Source |
|---|---|
| ACEA | ChEBI |
| arachidonyl-2-chloroethylamide | ChEBI |
| N-(2-chloroethyl)-5Z,8Z,11Z,14Z-eicosatetraenamide | ChEBI |
| (5Z,8Z,11Z,14Z)-N-(2-chloroethyl)-5,8,11,14-eicosatetraenamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0247891 | HMDB |
| 4470547 | ChemSpider |
| Arachidonyl-2'-chloroethylamide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:220556-69-4 | ChemIDplus |
| Citations |
|---|