EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO9S2 |
| Net Charge | 0 |
| Average Mass | 437.492 |
| Monoisotopic Mass | 437.08142 |
| SMILES | O=S(=O)(O)O/N=C(\CCCc1ccccc1)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H23NO9S2/c18-9-11-13(19)14(20)15(21)16(25-11)27-12(17-26-28(22,23)24)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,11,13-16,18-21H,4,7-9H2,(H,22,23,24)/b17-12+ |
| InChIKey | AAVHHGNQWFTUKS-SFQUDFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Phenylpropyl glucosinolate (CHEBI:191822) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-4-phenyl-N-sulooxybutanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014578 | ChemSpider |
| HMDB0038422 | HMDB |