EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C=C(CCC=C(C)C)C1CC=C(CCC=C(C)C)CC1 |
| InChI | InChI=1S/C20H32/c1-16(2)8-6-10-18(5)20-14-12-19(13-15-20)11-7-9-17(3)4/h8-9,12,20H,5-7,10-11,13-15H2,1-4H3 |
| InChIKey | GJYJYFHBOBUTBY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | - | PubMed (33805665) | |
| Commiphora wightii (ncbitaxon:246360) | - | PubMed (26587309) | |
| Geophila repens (ncbitaxon:58419) | - | PubMed (28926976) | |
| Houttuynia cordata (ncbitaxon:16752) | - | PubMed (34326877) | |
| Juniperus communis (ncbitaxon:58039) | - | PubMed (26784665) | |
| Pimenta dioica (ncbitaxon:375272) | - | PubMed (33050259) | |
| Pinus halepensis (ncbitaxon:71633) | aerial part (BTO:0001658) | DOI (10.1016/s2222-1808(14)60323-6) | |
| Ulmus parvifolia (ncbitaxon:63058) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) | ||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-camphorene (CHEBI:191730) has role volatile oil component (CHEBI:27311) |
| α-camphorene (CHEBI:191730) is a cycloalkene (CHEBI:33643) |
| α-camphorene (CHEBI:191730) is a diterpene (CHEBI:35190) |
| IUPAC Name |
|---|
| 4-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-en-1-yl)cyclohexene |
| Synonyms | Source |
|---|---|
| 4-(5-methyl-1-methylene-4-hexenyl)-1-(4-methyl-3-pentenyl)cyclohexene | ChEBI |
| 4-(5-methyl-1-methylene-4-hexenyl)-1-(4-methylpent-3-enyl)cyclohexene | ChemIDplus |
| 4-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-en-1-yl)cyclohex-1-ene | IUPAC |
| 4-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-enyl)cyclohexene | IUPAC |
| alpha-camphorene | ChemIDplus |
| dimyrcene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 91936 | ChemSpider |
| C00054831 | KNApSAcK |
| FDB015806 | FooDB |
| HMDB0036852 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:532-87-6 | ChemIDplus |
| Citations |
|---|