EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O9S |
| Net Charge | 0 |
| Average Mass | 411.353 |
| Monoisotopic Mass | 411.08085 |
| SMILES | N=C1N(O)C(COC(N)=O)C2N=C(N)NC23N1CC(OS(=O)(=O)O)C3(O)O |
| InChI | InChI=1S/C10H17N7O9S/c11-6-14-5-3(2-25-8(13)18)17(21)7(12)16-1-4(26-27(22,23)24)10(19,20)9(5,16)15-6/h3-5,12,19-21H,1-2H2,(H2,13,18)(H3,11,14,15)(H,22,23,24) |
| InChIKey | CETRDCWBMBILAL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) | ||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gonyautoxin I (CHEBI:191705) has role marine metabolite (CHEBI:76507) |
| Gonyautoxin I (CHEBI:191705) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (2-amino-5,10,10-trihydroxy-6-imino-9-sulooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl)methyl carbamate |
| Manual Xrefs | Databases |
|---|---|
| 35013616 | ChemSpider |
| HMDB0033508 | HMDB |