EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O4 |
| Net Charge | 0 |
| Average Mass | 267.285 |
| Monoisotopic Mass | 267.12191 |
| SMILES | NC(CCC(=O)NNc1ccc(CO)cc1)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c13-10(12(18)19)5-6-11(17)15-14-9-3-1-8(7-16)2-4-9/h1-4,10,14,16H,5-7,13H2,(H,15,17)(H,18,19) |
| InChIKey | SRSPQXBFDCGXIZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Agaritine (CHEBI:191700) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-5-[2-[4-(hydroxymethyl)phenyl]hydrazinyl]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16720 | ChemSpider |
| HMDB0033758 | HMDB |