EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O9 |
| Net Charge | 0 |
| Average Mass | 512.555 |
| Monoisotopic Mass | 512.20463 |
| SMILES | [H][C@]12CC[C@]3(O)C(=O)O[C@]4(C)[C@]35O[C@@](O)(C(=O)[C@@]5([H])[C@]3(C)C[C@@]4([H])OC(=O)[C@H]3C)[C@]1([H])CC=C1C=CCC(=O)[C@@]12C |
| InChI | InChI=1S/C28H32O9/c1-13-21(31)35-18-12-23(13,2)19-20(30)27(34)16-9-8-14-6-5-7-17(29)24(14,3)15(16)10-11-26(33)22(32)36-25(18,4)28(19,26)37-27/h5-6,8,13,15-16,18-19,33-34H,7,9-12H2,1-4H3/t13-,15+,16-,18-,19+,23-,24+,25+,26+,27-,28+/m1/s1 |
| InChIKey | DRSSQOIGUIMEGX-ILWTWGIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Physalin M (CHEBI:191688) is a physalin (CHEBI:76361) |
| IUPAC Name |
|---|
| (1S,2S,3R,5R,6R,14R,15S,18R,21S,22R,25S)-5,18-dihydroxy-1,14,21,25-tetramethyl-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,10-diene-13,19,24,27-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 103881791 | ChemSpider |