EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3S |
| Net Charge | 0 |
| Average Mass | 219.313 |
| Monoisotopic Mass | 219.08302 |
| SMILES | c1ccc2c(N3CCNCC3)nsc2c1 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 |
| InChIKey | KRDOFMHJLWKXIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ID11614 (CHEBI:191681) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| 3-piperazin-1-yl-1,2-benzothiazole |
| Manual Xrefs | Databases |
|---|---|
| 2052573 | ChemSpider |
| HMDB0061056 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:87691-87-0 | ChemIDplus |