EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO11S3 |
| Net Charge | 0 |
| Average Mass | 481.567 |
| Monoisotopic Mass | 481.07462 |
| SMILES | CS(=O)(=O)CCCCCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C14H27NO11S3/c1-28(20,21)7-5-3-2-4-6-10(15-26-29(22,23)24)27-14-13(19)12(18)11(17)9(8-16)25-14/h9,11-14,16-19H,2-8H2,1H3,(H,22,23,24)/b15-10+ |
| InChIKey | ILRMEXURGOFHMQ-XNTDXEJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(Methylsulfonyl)hexyl glucosinolate (CHEBI:191676) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-7-methylsulonyl-N-sulooxyheptanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038411 | HMDB |
| 35014569 | ChemSpider |