EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O5 |
| Net Charge | 0 |
| Average Mass | 281.268 |
| Monoisotopic Mass | 281.10117 |
| SMILES | NC(CCC(=O)NNc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C12H15N3O5/c13-9(12(19)20)5-6-10(16)15-14-8-3-1-7(2-4-8)11(17)18/h1-4,9,14H,5-6,13H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | GCENCHHONAGMNP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) | ||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-(gamma-Glutamyl)-4-carboxyphenylhydrazine (CHEBI:191667) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 4-[2-(4-amino-4-carboxybutanoyl)hydrazinyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3816422 | ChemSpider |