EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H60O4 |
| Net Charge | 0 |
| Average Mass | 508.828 |
| Monoisotopic Mass | 508.44916 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCCCCC)CCCC(=O)O |
| InChI | InChI=1S/C32H60O4/c1-3-5-7-9-11-13-14-15-16-18-20-22-24-29-32(35)36-30(27-25-28-31(33)34)26-23-21-19-17-12-10-8-6-4-2/h13-14,30H,3-12,15-29H2,1-2H3,(H,33,34)/b14-13- |
| InChIKey | SVLKUGBXYAQXIT-YPKPFQOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FAHFA(16:1(9Z)/5-O-16:0) (CHEBI:191608) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 5-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849783 | ChemSpider |
| HMDB0112154 | HMDB |
| LMFA07011082 | LIPID MAPS |