EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | CCCCCCC/C=C/C(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C19H26O3/c1-3-4-5-6-7-8-9-10-17(20)13-11-16-12-14-18(21)19(15-16)22-2/h9-15,21H,3-8H2,1-2H3/b10-9+,13-11+ |
| InChIKey | WTJRJJFXDZXSLU-SNMPHBPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) | ||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [8]-Dehydroshogaol (CHEBI:191579) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)dodeca-1,4-dien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 7972194 | ChemSpider |