EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O12 |
| Net Charge | 0 |
| Average Mass | 458.416 |
| Monoisotopic Mass | 458.14243 |
| SMILES | COc1cc(/C=C/C(=O)OC2C(OC3C(O)COC(O)C3O)OC(CO)C2O)ccc1O |
| InChI | InChI=1S/C20H26O12/c1-28-12-6-9(2-4-10(12)22)3-5-14(24)31-18-15(25)13(7-21)30-20(18)32-17-11(23)8-29-19(27)16(17)26/h2-6,11,13,15-23,25-27H,7-8H2,1H3/b5-3+ |
| InChIKey | ZXAPYACNVQHJGD-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-(E)-Feruloyl-3-(arabinosylxylose) (CHEBI:191559) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [4-hydroxy-5-(hydroxymethyl)-2-(2,3,5-trihydroxyoxan-4-yl)oxyoxolan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030230 | HMDB |