EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29NO11 |
| Net Charge | 0 |
| Average Mass | 531.514 |
| Monoisotopic Mass | 531.17406 |
| SMILES | CN1CCc2cc3c(cc2C2OC(OC4OC(CO)C(O)C(O)C4O)c4c(ccc5c4OCO5)C21)OCO3 |
| InChI | InChI=1S/C26H29NO11/c1-27-5-4-11-6-15-16(34-9-33-15)7-13(11)23-19(27)12-2-3-14-24(35-10-32-14)18(12)25(37-23)38-26-22(31)21(30)20(29)17(8-28)36-26/h2-3,6-7,17,19-23,25-26,28-31H,4-5,8-10H2,1H3 |
| InChIKey | LOJGKLLTOGPATF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alkaloid RC (CHEBI:191551) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-6-[(13-methyl-5,7,19,21,25-pentaoxa-13-azahexacyclo[12.11.0.02,10.04,8.015,23.018,22]pentacosa-2,4(8),9,15(23),16,18(22)-hexaen-24-yl)oxy]oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029361 | HMDB |