EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O12 |
| Net Charge | 0 |
| Average Mass | 462.363 |
| Monoisotopic Mass | 462.07983 |
| SMILES | COc1c(O)cc2c(=O)oc3c(OC4OC(C)C(O)C(O)C4O)c(O)cc4c(=O)oc1c2c34 |
| InChI | InChI=1S/C21H18O12/c1-5-12(24)13(25)14(26)21(30-5)33-16-9(23)4-7-11-10-6(20(28)32-18(11)16)3-8(22)15(29-2)17(10)31-19(7)27/h3-5,12-14,21-26H,1-2H3 |
| InChIKey | UNIJYMVRSKZTJI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulmus parvifolia (ncbitaxon:63058) | |||
| bark (BTO:0001301) | MetaboLights (MTBLS4572) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS4572) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylellagic acid 8-rhamnoside (CHEBI:191529) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6,13-dihydroxy-7-methoxy-14-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037079 | HMDB |