EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O4 |
| Net Charge | 0 |
| Average Mass | 162.145 |
| Monoisotopic Mass | 162.06406 |
| SMILES | NC(=O)C(O)CC(N)C(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-2(5(10)11)1-3(8)4(7)9/h2-3,8H,1,6H2,(H2,7,9)(H,10,11) |
| InChIKey | VTJRNXQBJNWLRA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-4-Hydroxyglutamine (CHEBI:191526) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2,5-diamino-4-hydroxy-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13488647 | ChemSpider |
| HMDB0029424 | HMDB |