EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO6 |
| Net Charge | 0 |
| Average Mass | 383.400 |
| Monoisotopic Mass | 383.13689 |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=O)c1ccc3c(c1CN(C)CC2)OCO3 |
| InChI | InChI=1S/C21H21NO6/c1-22-7-6-12-8-17(25-2)18(26-3)9-14(12)20(24)19(23)13-4-5-16-21(15(13)10-22)28-11-27-16/h4-5,8-9H,6-7,10-11H2,1-3H3 |
| InChIKey | UFCVPEFVGGMGSE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum tuberosum (ncbitaxon:4113) | leaf (BTO:0000713) | MetaboLights (MTBLS4365) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-Oxocryptopine (CHEBI:191441) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 6,7-dimethoxy-12-methyl-16,18-dioxa-12-azatetracyclo[12.7.0.04,9.015,19]henicosa-1(14),4,6,8,15(19),20-hexaene-2,3-dione |
| Manual Xrefs | Databases |
|---|---|
| 30776957 | ChemSpider |
| HMDB0032878 | HMDB |