EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | [H]C(=O)/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h7,9,11H,1-6,8,10H2,(H,14,15)/b9-7+ |
| InChIKey | INMKWUNQKOWGEZ-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) has functional parent trans-10-dodecenoic acid (CHEBI:38378) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) has role plant hormone (CHEBI:37848) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) is a medium-chain fatty acid (CHEBI:59554) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) is a monounsaturated fatty acid (CHEBI:25413) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) is a oxo fatty acid (CHEBI:59644) |
| 12-oxo-trans-10-dodecenoic acid (CHEBI:19144) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| (10E)-12-oxododec-10-enoic acid |
| Synonyms | Source |
|---|---|
| traumatin | ChemIDplus |
| Δ10-ODA | ChemIDplus |
| 12-oxo-10E-dodecenoic acid | LIPID MAPS |
| 12-oxo-trans-dodec-10-enoic acid | ChEBI |
| 12-oxo-(E)-10-dodecenoic acid | ChEBI |
| 12-Oxo-dodec-10t-ensäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060093 | LIPID MAPS |
| C16309 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1707657 | Reaxys |
| CAS:65410-38-0 | ChemIDplus |
| CAS:65410-38-0 | KEGG COMPOUND |
| Citations |
|---|