EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | [H]C(=O)C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h5,7,11H,1-4,6,8-10H2,(H,14,15)/b7-5- |
| InChIKey | KIHXTOVLSZRTHJ-ALCCZGGFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-cis-dodec-9-enoic acid (CHEBI:19143) has functional parent cis-9-dodecenoic acid (CHEBI:38377) |
| 12-oxo-cis-dodec-9-enoic acid (CHEBI:19143) is a aldehyde (CHEBI:17478) |
| 12-oxo-cis-dodec-9-enoic acid (CHEBI:19143) is a oxo fatty acid (CHEBI:59644) |
| IUPAC Name |
|---|
| (9Z)-12-oxododec-9-enoic acid |
| Synonym | Source |
|---|---|
| 12-oxo-9Z-dodecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16311 | KEGG COMPOUND |
| LMFA01060167 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2964596 | Beilstein |
| Citations |
|---|