EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4FNO |
| Net Charge | 0 |
| Average Mass | 77.058 |
| Monoisotopic Mass | 77.02769 |
| SMILES | NCC(=O)F |
| InChI | InChI=1S/C2H4FNO/c3-2(5)1-4/h1,4H2 |
| InChIKey | SQRVIASYMYTAPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminoacetyl fluoride (CHEBI:191412) has functional parent acetyl fluoride (CHEBI:191932) |
| 2-aminoacetyl fluoride (CHEBI:191412) has role carcinogenic agent (CHEBI:50903) |
| 2-aminoacetyl fluoride (CHEBI:191412) is a acyl fluoride (CHEBI:38110) |
| 2-aminoacetyl fluoride (CHEBI:191412) is a organofluorine compound (CHEBI:37143) |
| 2-aminoacetyl fluoride (CHEBI:191412) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| glycyl fluoride |
| Synonyms | Source |
|---|---|
| 2-aminoacetylfluorine | SUBMITTER |
| 2-aminoethanoyl fluoride | SUBMITTER |
| H-Gly-F | ChEBI |
| Citations |
|---|