EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O6 |
| Net Charge | 0 |
| Average Mass | 348.310 |
| Monoisotopic Mass | 348.06339 |
| SMILES | O=C1OCc2cc3cc4c(cc3c(-c3ccc5c(c3)OCO5)c21)OCO4 |
| InChI | InChI=1S/C20H12O6/c21-20-19-12(7-22-20)3-11-5-16-17(26-9-25-16)6-13(11)18(19)10-1-2-14-15(4-10)24-8-23-14/h1-6H,7-9H2 |
| InChIKey | YMGOOHXUOWZQOE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthopanax henryi (IPNI:89458-1) | - | PubMed (30915141) | |
| Cleistanthus patulus (IPNI:341431-1) | - | PubMed (17404921) | |
| Eleutherococcus divaricatus var. chiisanensis (ncbitaxon:96666) | Root (BTO:0001188) | PubMed (12392817) | Species also known as Acanthopanax chiisanensis. |
| Justicia procumbens (ncbitaxon:859317) | - | PubMed (21328534) | |
| Taiwania cryptomerioides (ncbitaxon:50187) | - | PubMed (11142847) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taiwanin C (CHEBI:191411) has role antineoplastic agent (CHEBI:35610) |
| taiwanin C (CHEBI:191411) has role plant metabolite (CHEBI:76924) |
| taiwanin C (CHEBI:191411) has role platelet aggregation inhibitor (CHEBI:50427) |
| taiwanin C (CHEBI:191411) is a benzodioxoles (CHEBI:38298) |
| taiwanin C (CHEBI:191411) is a furonaphthodioxole (CHEBI:50307) |
| taiwanin C (CHEBI:191411) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 5-(1,3-benzodioxol-5-yl)furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(8H)-one |
| Synonyms | Source |
|---|---|
| 5-(1,3-benzodioxol-5-yl)-8H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one | SUBMITTER |
| 5-(2H-1,3-benzodioxol-5-yl)-2H-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(8H)-one | IUPAC |
| 6,7-(epoxymethanoxy)-9-(1,3-benzodioxole-5-yl)-1,3-dihydronaphtho[2,3-c]furan-1-one | SUBMITTER |
| Citations |
|---|